CAS 1220039-60-0

1,1-Dimethylethyl 3-(aminoiminomethyl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(aminoiminomethyl)-1-piperidinecarboxylate, identified by its CAS number 1220039-60-0, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a tertiary carbon, contributing to its steric bulk. The aminoiminomethyl group indicates the presence of both amine and imine functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The carboxylate moiety suggests that the compound may exhibit acidic properties, potentially influencing its solubility and reactivity in different environments. Overall, this compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for biological activity or as a precursor in the synthesis of more complex molecules. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₁H₂₁N₃O₂

InChI: InChI=1S/C11H21N3O2/c1-11(2,3)16-10(15)14-6-4-5-8(7-14)9(12)13/h8H,4-7H2,1-3H3,(H3,12,13)

InChI key: InChIKey=VMBVTZTVUJHADD-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(C(=N)N)CCC1

Synonyms:

• 1,1-Dimethylethyl 3-(aminoiminomethyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-(aminoiminomethyl)-, 1,1-dimethylethyl ester