CAS 1220039-61-1

Imidazo[1,2-a]pyridine-2-carboxylic acid, 5-methyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system comprising both imidazole and pyridine moieties. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential biological activity due to its structural features. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions, while the hydrochloride form indicates it is a salt formed with hydrochloric acid, enhancing its solubility in polar solvents, particularly water. The methyl group at the 5-position of the imidazo ring may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology, potentially serving as a scaffold for drug development. Its specific applications and biological activities would depend on further research and characterization, including studies on its pharmacokinetics and mechanism of action.

Formula: C₉H₈N₂O₂·ClH

InChI: InChI=1S/C9H8N2O2.ClH/c1-6-3-2-4-8-10-7(9(12)13)5-11(6)8;/h2-5H,1H3,(H,12,13);1H

InChI key: InChIKey=YBWVKQFIQNZDAO-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(C(O)=O)=C2)C=CC1.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 5-methyl-, hydrochloride (1:1)