CAS 1220039-65-5
:Methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate
Description:
Methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate is a heterocyclic organic compound characterized by its complex structure, which includes a pyridine and pyrimidine ring system. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 4-position of the pyridine ring introduces unique electronic and steric effects, which can influence its chemical behavior and potential applications. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, and its derivatives could be explored for various pharmacological properties. Additionally, the compound's stability, solubility in organic solvents, and reactivity with nucleophiles or electrophiles are important characteristics that can be leveraged in synthetic chemistry. Overall, Methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate represents a versatile scaffold for further chemical modifications and research in various fields.
Formula:C9H6ClN3O2
InChI:InChI=1S/C9H6ClN3O2/c1-15-9(14)8-12-6-4-11-3-2-5(6)7(10)13-8/h2-4H,1H3
InChI key:InChIKey=ZYOTXZCWBGAGRH-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(C(OC)=O)N1)C=NC=C2
Synonyms:- Pyrido[3,4-d]pyrimidine-2-carboxylic acid, 4-chloro-, methyl ester
- Methyl 4-chloropyrido[3,4-d]pyrimidine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
