CAS 1220039-67-7

1,1-Dimethylethyl N-(6-ethoxy-3-nitro-2-pyridinyl)carbamate

Description:

1,1-Dimethylethyl N-(6-ethoxy-3-nitro-2-pyridinyl)carbamate, with the CAS number 1220039-67-7, is a chemical compound characterized by its unique structure, which includes a carbamate functional group and a pyridine ring substituted with an ethoxy and nitro group. This compound is typically used in agricultural applications, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The presence of the nitro group enhances its reactivity and potential biological activity, while the ethoxy group contributes to its solubility and stability in various environments. The tert-butyl group (1,1-dimethylethyl) provides steric hindrance, which can influence the compound's interaction with target enzymes or receptors. Overall, this compound exhibits properties that make it valuable in the field of agrochemicals, with a focus on efficacy and environmental impact. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₂H₁₇N₃O₅

InChI: InChI=1S/C12H17N3O5/c1-5-19-9-7-6-8(15(17)18)10(13-9)14-11(16)20-12(2,3)4/h6-7H,5H2,1-4H3,(H,13,14,16)

InChI key: InChIKey=ARTMGGCAJBVCBE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NC(OC(C)(C)C)=O)N=C(OCC)C=C1

Synonyms:

• Carbamic acid, N-(6-ethoxy-3-nitro-2-pyridinyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(6-ethoxy-3-nitro-2-pyridinyl)carbamate