CAS 1220039-83-7
:2,3-Dibromo-1H-pyrrolo[2,3-c]pyridine
Description:
2,3-Dibromo-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two bromine atoms at the 2 and 3 positions of the pyrrole ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the bromine substituents that can participate in various chemical reactions. Additionally, the compound may exhibit interesting electronic properties owing to the conjugated system formed by the fused rings. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling procedures should be followed in laboratory settings. Overall, 2,3-Dibromo-1H-pyrrolo[2,3-c]pyridine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C7H4Br2N2
InChI:InChI=1S/C7H4Br2N2/c8-6-4-1-2-10-3-5(4)11-7(6)9/h1-3,11H
InChI key:InChIKey=QVMIUTTWNGSBRO-UHFFFAOYSA-N
SMILES:BrC=1C=2C(NC1Br)=CN=CC2
Synonyms:- 2,3-Dibromo-1H-pyrrolo[2,3-c]pyridine
- 1H-Pyrrolo[2,3-c]pyridine, 2,3-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.