CAS 1220039-90-6

1H-1,2,4-Triazole-3-ethanamine, 5-phenyl-, hydrochloride (1:2)

Description:

1H-1,2,4-Triazole-3-ethanamine, 5-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with both triazoles and amines, including potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The phenyl group contributes to its hydrophobic characteristics, which may influence its interaction with biological systems. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or antifungal activity, common among triazole derivatives, and could be of interest in medicinal chemistry for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₂N₄·2ClH

InChI: InChI=1S/C10H12N4.2ClH/c11-7-6-9-12-10(14-13-9)8-4-2-1-3-5-8;;/h1-5H,6-7,11H2,(H,12,13,14);2*1H

InChI key: InChIKey=MUQVGLQUTFWWOA-UHFFFAOYSA-N

SMILES: C(CN)C=1NC(=NN1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-1,2,4-Triazole-3-ethanamine, 5-phenyl-, hydrochloride (1:2)

2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethan-1-amine dihydrochloride

CAS: 1220039-90-6

Formula: C₁₀H₁₄Cl₂N₄

Molecular weight: 261.1510

Ref: IN-DA0016LR

[2-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]amine dihydrochloride

CAS: 1220039-90-6

Formula: C₁₀H₁₄Cl₂N₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 261.15

Ref: 10-F308377

2-(5-Phenyl-2H-[1,2,4]triazol-3-yl)-ethylamine dihydrochloride

CAS: 1220039-90-6

Versatile small molecule scaffold

Formula: C₁₀H₁₄Cl₂N₄

Purity: Min. 95%

Molecular weight: 261.15 g/mol

Ref: 3D-VYB03990