CAS 1220039-93-9

1,1-Dimethylethyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2,3-dihydro-1H-indole-1-carboxylate

Description:

1,1-Dimethylethyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2,3-dihydro-1H-indole-1-carboxylate, identified by its CAS number 1220039-93-9, is a chemical compound characterized by its complex structure, which includes an indole moiety and various functional groups such as carboxylate and amine. This compound typically exhibits properties associated with both organic and medicinal chemistry, making it of interest in pharmaceutical research. The presence of the dimethylethyl group suggests potential lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the indole structure is known for its biological activity, often serving as a scaffold in drug design. The compound may also demonstrate specific reactivity due to the presence of the carboxylate and amine functionalities, which can participate in various chemical reactions, including coupling and acylation. Overall, this compound's unique structural features contribute to its potential applications in drug development and other chemical syntheses.

Formula: C₁₈H₂₆N₂O₄

InChI: InChI=1S/C18H26N2O4/c1-17(2,3)23-15(21)19-13-8-7-9-14-12(13)10-11-20(14)16(22)24-18(4,5)6/h7-9H,10-11H2,1-6H3,(H,19,21)

InChI key: InChIKey=LMHBCGKSOKSNDF-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C2C(N(C(OC(C)(C)C)=O)CC2)=CC=C1

Synonyms:

• 1H-Indole-1-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2,3-dihydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2,3-dihydro-1H-indole-1-carboxylate
• 1-Boc-4-Bocamino-indoline