CymitQuimica logo

CAS 1220039-94-0

:

6-Fluoroimidazo[1,2-a]pyridine-3-carboximidamide

Description:
6-Fluoroimidazo[1,2-a]pyridine-3-carboximidamide is a chemical compound characterized by its unique imidazo and pyridine ring structures, which contribute to its potential biological activity. The presence of a fluorine atom at the 6-position of the imidazo ring enhances its electronic properties and may influence its interaction with biological targets. The carboximidamide functional group indicates the presence of both carboxylic acid and amine characteristics, which can play a significant role in hydrogen bonding and molecular interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit activity against specific biological pathways or targets. Its molecular structure suggests that it could participate in various chemical reactions, making it a versatile candidate for further research. Additionally, the compound's solubility, stability, and reactivity would be important factors to consider in its practical applications. Overall, 6-Fluoroimidazo[1,2-a]pyridine-3-carboximidamide represents a class of compounds that may hold promise in therapeutic contexts.
Formula:C8H7FN4
InChI:InChI=1S/C8H7FN4/c9-5-1-2-7-12-3-6(8(10)11)13(7)4-5/h1-4H,(H3,10,11)
InChI key:InChIKey=AWGIXVPDSDMNPK-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1N2C(=NC1)C=CC(F)=C2
Synonyms:
  • Imidazo[1,2-a]pyridine-3-carboximidamide, 6-fluoro-
  • 6-Fluoroimidazo[1,2-a]pyridine-3-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.