CAS 1220040-02-7

1-Amino-2,3-dihydro-3-methyl-1H-indene-1-carboxylic acid

Description:

1-Amino-2,3-dihydro-3-methyl-1H-indene-1-carboxylic acid is an organic compound characterized by its indene structure, which features a fused ring system. This compound contains an amino group (-NH2) and a carboxylic acid group (-COOH), making it an amino acid derivative. The presence of the methyl group at the 3-position of the indene ring contributes to its unique properties, potentially influencing its reactivity and solubility. The compound is likely to exhibit both acidic and basic characteristics due to the functional groups present, allowing it to participate in various chemical reactions, such as amide formation or esterification. Additionally, its structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. The CAS number 1220040-02-7 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, this compound's distinct structural features and functional groups make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c1-7-6-11(12,10(13)14)9-5-3-2-4-8(7)9/h2-5,7H,6,12H2,1H3,(H,13,14)

InChI key: InChIKey=WJVNCTQTMOGDLG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)C=2C(C(C)C1)=CC=CC2

Synonyms:

• 1H-Indene-1-carboxylic acid, 1-amino-2,3-dihydro-3-methyl-
• 1-Amino-2,3-dihydro-3-methyl-1H-indene-1-carboxylic acid