CAS 1220040-04-9

Carbamic acid, N-[(4-aminophenyl)methyl]-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-[(4-aminophenyl)methyl]-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a carbamic acid moiety, an aromatic amine, and a fluorenyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its functional groups. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility and stability in aqueous environments. The compound may exhibit biological activity due to the presence of the amino group, which can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. Its unique structure suggests potential applications in medicinal chemistry, particularly in drug development, where modifications to the fluorenyl or amino groups could lead to derivatives with enhanced pharmacological properties. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks depending on exposure levels.

Formula: C₂₂H₂₀N₂O₂·ClH

InChI: InChI=1S/C22H20N2O2.ClH/c23-16-11-9-15(10-12-16)13-24-22(25)26-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21;/h1-12,21H,13-14,23H2,(H,24,25);1H

InChI key: InChIKey=UMTSALRFHKJCHG-UHFFFAOYSA-N

SMILES: C(OC(NCC1=CC=C(N)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3.Cl

Synonyms:

• Carbamic acid, N-[(4-aminophenyl)methyl]-, 9H-fluoren-9-ylmethyl ester, hydrochloride (1:1)