
CAS 1220040-11-8
:7-Bromo-1H-indazole-3-methanol
Description:
7-Bromo-1H-indazole-3-methanol is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 7-position and a hydroxymethyl group (-CH2OH) at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxymethyl group, influencing its solubility and interaction with biological targets. Additionally, the bromine substituent can enhance lipophilicity and may serve as a site for further chemical modifications. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 7-Bromo-1H-indazole-3-methanol represents a versatile scaffold for further exploration in drug development and synthetic chemistry.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c9-6-3-1-2-5-7(4-12)10-11-8(5)6/h1-3,12H,4H2,(H,10,11)
InChI key:InChIKey=PJKCIJUMQGHHBV-UHFFFAOYSA-N
SMILES:C(O)C=1C=2C(=C(Br)C=CC2)NN1
Synonyms:- 1H-Indazole-3-methanol, 7-bromo-
- 7-Bromo-1H-indazole-3-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.