CymitQuimica logo

CAS 1220040-18-5

:

4-Piperidinone, 3-methoxy-, hydrochloride (1:1)

Description:
4-Piperidinone, 3-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which features a six-membered ring containing nitrogen and a ketone functional group. The presence of a methoxy group at the 3-position enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it useful in various applications, including pharmaceuticals and organic synthesis. This compound may exhibit biological activity, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Piperidinone, 3-methoxy-, hydrochloride is an important compound in the field of organic chemistry and medicinal chemistry.
Formula:C6H11NO2·ClH
InChI:InChI=1S/C6H11NO2.ClH/c1-9-6-4-7-3-2-5(6)8;/h6-7H,2-4H2,1H3;1H
InChI key:InChIKey=PKGPGHKLZIQCSO-UHFFFAOYSA-N
SMILES:O(C)C1C(=O)CCNC1.Cl
Synonyms:
  • 3-Methoxy-piperidin-4-one hydrochloride
  • 4-Piperidinone, 3-methoxy-, hydrochloride (1:1)
  • 3-Methoxypiperidin-4-one hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.