
CAS 1220040-23-2
:Methyl 5-amino-1H-pyrrole-3-carboxylate
Description:
Methyl 5-amino-1H-pyrrole-3-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an amino group (-NH2) and a carboxylate group (-COOCH3) attached to the pyrrole ring, contributing to its reactivity and potential applications in medicinal chemistry and organic synthesis. The presence of the amino group allows for various substitution reactions, while the carboxylate moiety can participate in esterification and other reactions. Methyl 5-amino-1H-pyrrole-3-carboxylate is typically a solid at room temperature and may exhibit solubility in polar solvents due to its functional groups. Its molecular structure suggests potential biological activity, making it a candidate for further research in drug development or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-10-6(9)4-2-5(7)8-3-4/h2-3,8H,7H2,1H3
InChI key:InChIKey=MLQZLMNUUQWPTB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(N)NC1
Synonyms:- Methyl 5-amino-1H-pyrrole-3-carboxylate
- 1H-Pyrrole-3-carboxylic acid, 5-amino-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.