CymitQuimica logo

CAS 122005-24-7

:

Octacosamicin B

Description:
Octacosamicin B is a complex organic compound classified as a glycosylated alkaloid. It is derived from natural sources, particularly certain species of plants and fungi. The structure of Octacosamicin B features a long carbon chain, which contributes to its hydrophobic properties, along with functional groups that enhance its solubility in organic solvents. This compound is known for its potential biological activities, including antimicrobial and cytotoxic effects, making it of interest in pharmaceutical research. Its molecular weight and specific stereochemistry play crucial roles in its reactivity and interaction with biological systems. Additionally, Octacosamicin B may exhibit unique properties due to its glycosidic linkages, which can influence its bioavailability and mechanism of action. As with many natural products, the study of Octacosamicin B involves exploring its synthesis, isolation, and potential applications in medicine and biotechnology. Further research is necessary to fully understand its mechanisms and potential therapeutic uses.
Formula:C32H54N4O9
InChI:InChI=1/C32H54N4O9/c1-24(27(39)21-26(38)22-28(40)30(43)31(44)35-23-29(41)42)17-13-9-5-2-3-6-10-14-18-25(37)19-15-11-7-4-8-12-16-20-36(45)32(33)34/h2-3,5-7,11,15,19,24,26-28,30,38-40,43,45H,4,8-10,12-14,16-18,20-23H2,1H3,(H3,33,34)(H,35,44)(H,41,42)/b5-2+,6-3+,11-7+,19-15+
Synonyms:
  • Glycine, N-[28-[(aminoiminomethyl)hydroxyamino]-2,3,5,7-tetrahydroxy-8-methyl-1,19-dioxo-12,14,20,22-octacosatetraenyl]- (9CI)
  • Octacosamicin B
  • 2-[[(12E,14E,20E,22E)-28-[carbamimidoyl(hydroxy)amino]-2,3,5,7-tetrahydroxy-8-methyl-19-oxooctacosa-12,14,20,22-tetraenoyl]amino]acetic acid
  • ({(12E,14E,20E,22E)-28-[carbamimidoyl(hydroxy)amino]-2,3,5,7-tetrahydroxy-8-methyl-19-oxooctacosa-12,14,20,22-tetraenoyl}amino)acetic acid (non-preferred name)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Octacosamicin B

    CAS:
    <p>Octacosamicin B exhibits activity against bacteria, yeast, and filamentous fungi, although its antibacterial effectiveness is relatively weak.</p>
    Formula:C32H54N4O9
    Color and Shape:Solid
    Molecular weight:638.793