CAS 122008-86-0
:3-Fluoro-4-(4-hydroxyphenoxy)benzonitrile
Description:
3-Fluoro-4-(4-hydroxyphenoxy)benzonitrile, with the CAS number 122008-86-0, is an organic compound characterized by its complex aromatic structure. It features a fluorine atom and a hydroxyl group attached to a phenyl ring, contributing to its unique chemical properties. The presence of the benzonitrile functional group indicates that it contains a cyano group (-C≡N), which can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophilic (hydroxyl) and hydrophobic (aromatic) components. Its fluorine substitution can enhance lipophilicity and may affect its biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's stability is generally high under standard conditions, but it may undergo reactions typical of aromatic compounds, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Overall, 3-Fluoro-4-(4-hydroxyphenoxy)benzonitrile is a versatile compound with potential applications in various fields, including medicinal chemistry and material science.
Formula:C13H8FNO2
InChI:InChI=1S/C13H8FNO2/c14-12-7-9(8-15)1-6-13(12)17-11-4-2-10(16)3-5-11/h1-7,16H
InChI key:InChIKey=AWZMGTJMKXQLPR-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(C#N)C=C1)C2=CC=C(O)C=C2
Synonyms:- 3-Fluoro-4-(4-hydroxyphenoxy)-benzonitrile
- 3-Fluoro-4-(4-hydroxyphenoxy)benzonitrile
- Benzonitrile, 3-fluoro-4-(4-hydroxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
