CAS 122009-11-4

Ethyl 4-(diethoxyphosphinyl)-2-methyl-2-butenoate

Description:

Ethyl 4-(diethoxyphosphinyl)-2-methyl-2-butenoate, identified by its CAS number 122009-11-4, is a chemical compound that belongs to the class of organophosphorus compounds. It features a phosphinyl group, which is characteristic of its potential use in various applications, including as a pesticide or in organic synthesis. The structure includes an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. This compound is likely to exhibit moderate to high toxicity, typical of many organophosphorus compounds, necessitating careful handling and storage. Its unique configuration, with a double bond in the butenoate moiety, may impart specific reactivity patterns, making it useful in further chemical transformations. Additionally, the presence of diethoxy groups enhances its stability and solubility, which can influence its behavior in biological systems. As with any chemical substance, understanding its properties, including its reactivity, stability, and potential environmental impact, is crucial for safe and effective use.

Formula: C₁₁H₂₁O₅P

InChI: InChI=1S/C11H21O5P/c1-5-14-11(12)10(4)8-9-17(13,15-6-2)16-7-3/h8H,5-7,9H2,1-4H3

InChI key: InChIKey=UJTQBEHQOLXVAK-UHFFFAOYSA-N

SMILES: P(CC=C(C(OCC)=O)C)(OCC)(OCC)=O

Synonyms:

• Ethyl 4-(diethoxyphosphinyl)-2-methyl-2-butenoate
• 2-Butenoic acid, 4-(diethoxyphosphinyl)-2-methyl-, ethyl ester

2-Butenoic acid, 4-(diethoxyphosphinyl)-2-methyl-, ethyl ester

CAS: 122009-11-4

Formula: C₁₁H₂₁O₅P

Molecular weight: 264.2552

Ref: IN-DA0016LY