
CAS 1220112-75-3
:Poly(oxy-1,2-ethanediyl), α-(3-carboxypropyl)-ω-[2-[(3-mercapto-1-oxopropyl)amino]ethoxy]-
Description:
Poly(oxy-1,2-ethanediyl), α-(3-carboxypropyl)-ω-[2-[(3-mercapto-1-oxopropyl)amino]ethoxy]- is a complex polymeric compound characterized by its polyether backbone, which is derived from ethylene oxide. This substance features functional groups that include carboxylic acid and mercapto groups, contributing to its potential reactivity and ability to form various chemical bonds. The presence of the amino group suggests that it can participate in amine-related reactions, making it useful in applications such as drug delivery, surface modification, and as a stabilizing agent in formulations. Its amphiphilic nature, due to the combination of hydrophilic polyether segments and hydrophobic functional groups, allows it to interact with both aqueous and organic environments. This compound may also exhibit biocompatibility, making it suitable for biomedical applications. Overall, its unique structure and functional groups provide versatility in various chemical and industrial applications, particularly in the fields of materials science and pharmaceuticals.
Formula:(C2H4O)nC9H17NO4S
Synonyms:- Poly(oxy-1,2-ethanediyl), α-(3-carboxypropyl)-ω-[2-[(3-mercapto-1-oxopropyl)amino]ethoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
o-(3-Carboxypropyl)-O′-[2-(3-mercaptopropionylamino)ethyl]-polyethylene glycol
CAS:Controlled ProductPlease enquire for more information about o-(3-Carboxypropyl)-O′-[2-(3-mercaptopropionylamino)ethyl]-polyethylene glycol including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%Molecular weight:3,000 g/mol
