CymitQuimica logo

CAS 122016-41-5

:

3-(2-Nitroethyl)furan

Description:
3-(2-Nitroethyl)furan is an organic compound characterized by the presence of a furan ring, which is a five-membered aromatic heterocycle containing oxygen. The compound features a nitroethyl substituent at the 3-position of the furan ring, contributing to its unique chemical properties. It is typically a yellow to brown liquid or solid, depending on its purity and specific conditions. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the reactivity of the furan ring, making it more susceptible to electrophilic attack. This compound may exhibit moderate to high polarity due to the presence of the nitro group, affecting its solubility in various solvents. Additionally, 3-(2-Nitroethyl)furan may participate in various chemical reactions, including nucleophilic substitutions and reductions, making it of interest in synthetic organic chemistry. Safety data should be consulted, as nitro compounds can be hazardous and may require careful handling and storage.
Formula:C6H7NO3
InChI:InChI=1S/C6H7NO3/c8-7(9)3-1-6-2-4-10-5-6/h2,4-5H,1,3H2
InChI key:InChIKey=QVDFTFJNJZJHTH-UHFFFAOYSA-N
SMILES:C(CN(=O)=O)C=1C=COC1
Synonyms:
  • Furan, 3-(2-nitroethyl)-
  • 3-(2-Nitroethyl)furan
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.