CAS 122018-91-1
:ser-phe-pro-trp-met-glu-ser-asp-val-thr
Description:
The chemical substance with the name "ser-phe-pro-trp-met-glu-ser-asp-val-thr" and CAS number 122018-91-1 is a peptide composed of a sequence of amino acids. This peptide consists of serine (Ser), phenylalanine (Phe), proline (Pro), tryptophan (Trp), methionine (Met), glutamic acid (Glu), aspartic acid (Asp), valine (Val), and threonine (Thr). Peptides like this one are characterized by their specific sequence of amino acids, which determines their structure and function. They can exhibit various biological activities, including roles in signaling, enzyme activity, and cellular communication. The presence of aromatic amino acids, such as phenylalanine and tryptophan, may contribute to the peptide's ability to interact with other biomolecules. Additionally, the peptide's hydrophilicity or hydrophobicity can influence its solubility and stability in biological systems. Overall, this peptide's characteristics are defined by its amino acid composition and sequence, which play crucial roles in its biological functions and potential applications in biotechnology and medicine.
Formula:C54H75N11O18S
InChI:InChI=1/C54H75N11O18S/c1-27(2)43(52(80)64-44(28(3)68)54(82)83)63-49(77)37(23-42(71)72)59-50(78)39(26-67)62-46(74)34(16-17-41(69)70)57-47(75)35(18-20-84-4)58-48(76)36(22-30-24-56-33-14-9-8-13-31(30)33)60-51(79)40-15-10-19-65(40)53(81)38(61-45(73)32(55)25-66)21-29-11-6-5-7-12-29/h5-9,11-14,24,27-28,32,34-40,43-44,56,66-68H,10,15-23,25-26,55H2,1-4H3,(H,57,75)(H,58,76)(H,59,78)(H,60,79)(H,61,73)(H,62,74)(H,63,77)(H,64,80)(H,69,70)(H,71,72)(H,82,83)/t28-,32+,34+,35+,36+,37+,38+,39+,40+,43+,44+/m1/s1
Synonyms:- L-Threonine, N-(N-(N-(N-(N-(N-(N-(1-(N-L-seryl-L-phenylalanyl)-L-prolyl)-L-tryptophyl)-L-methionyl)-L-alpha-glutamyl)-L-seryl)-L-alpha-aspartyl)-L-valyl)-
- Prepro-trh (160-169)
- Prepro-thyrotropin releasing hormone (160-169)
- Thyrotropin-releasing hormone-potentiating peptide
- Ser-phe-pro-trp-met-glu-ser-asp-val-thr
- L-seryl-L-phenylalanyl-L-prolyl-L-tryptophyl-L-methionyl-L-alpha-glutamyl-L-seryl-L-alpha-aspartyl-L-valyl-L-threonine
- Trh-potentiating peptide
- Seryl-phenylalanyl-prolyl-tryptophyl-methionyl-glutamyl-seryl-asparaginyl-valyl-threonine
- L-Threonine, L-seryl-L-phenylalanyl-L-prolyl-L-tryptophyl-L-methionyl-L-α-glutamyl-L-seryl-L-α-aspartyl-L-valyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Prepro-TRH-(160-169)
CAS:<p>Prepro-TRH-(160-169), a pro-TRH peptide, enhances TRH-stimulated TSH secretion.</p>Formula:C54H75N11O18SColor and Shape:SolidMolecular weight:1198.3
