CAS 122018-92-2
:prepro-thyrotropin releasing hormone*fragment 178
Description:
Prepro-thyrotropin-releasing hormone fragment 178, associated with the CAS number 122018-92-2, is a peptide derived from the precursor molecule prepro-thyrotropin-releasing hormone (prepro-TRH). This fragment plays a role in the regulation of thyroid-stimulating hormone (TSH) release from the anterior pituitary gland. Characteristically, it is a small peptide that exhibits biological activity related to the hypothalamic-pituitary-thyroid axis. The structure of this fragment typically includes a sequence of amino acids that contribute to its function in neuroendocrine signaling. It is important in the context of neuropeptide signaling and may influence various physiological processes, including metabolism and growth. The fragment is often studied in the context of thyroid function and disorders related to thyroid hormone regulation. As a peptide, it is generally soluble in aqueous solutions and may require specific conditions for stability and activity. Further research into its properties and interactions can provide insights into its potential therapeutic applications.
Formula:C116H176N28O39S
InChI:InChI=1/C116H176N28O39S/c1-10-61(8)95(142-96(163)65(118)51-62-21-12-11-13-22-62)112(179)139-80(53-93(161)162)114(181)144-47-20-27-82(144)109(176)133-74(34-41-91(157)158)104(171)136-77(49-58(2)3)105(172)131-71(29-36-84(119)146)101(168)128-68(26-18-45-122-116(120)121)100(167)140-81(57-145)108(175)137-79(52-63-54-123-66-24-15-14-23-64(63)66)107(174)132-73(33-40-90(155)156)103(170)130-72(32-39-89(153)154)102(169)127-67(25-16-17-44-117)99(166)129-70(31-38-88(151)152)98(165)124-55-85(147)126-69(30-37-87(149)150)97(164)125-56-86(148)141-94(60(6)7)111(178)138-78(50-59(4)5)106(173)134-75(43-48-184-9)113(180)143-46-19-28-83(143)110(177)135-76(115(182)183)35-42-92(159)160/h11-15,21-24,54,58-61,65,67-83,94-95,123,145H,10,16-20,25-53,55-57,117-118H2,1-9H3,(H2,119,146)(H,124,165)(H,125,164)(H,126,147)(H,127,169)(H,128,168)(H,129,166)(H,130,170)(H,131,172)(H,132,174)(H,133,176)(H,134,173)(H,135,177)(H,136,171)(H,137,175)(H,138,178)(H,139,179)(H,140,167)(H,141,148)(H,142,163)(H,149,150)(H,151,152)(H,153,154)(H,155,156)(H,157,158)(H,159,160)(H,161,162)(H,182,183)(H4,120,121,122)/t61-,65-,67-,68-,69-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,94-,95-/m0/s1
Synonyms:- Corticotropin Release-Inhibiting Factor
- L-Glutamic acid, L-phenylalanyl-L-isoleucyl-L-alpha-aspartyl-L-prolyl-L-alpha-glutamyl-L-leucyl-L-glutaminyl-L-arginyl-L-seryl-L-typtophyl-L-alpha-glutamyl-L-alpha-glutamyl-L-lysyl-L-alpha-glutamylglycyl-L-alpha-glutamylglycyl-L-valyl-L-leucyl-L-methionyl-L-prolyl-
- Prepro-trh (178-199)
- Prepro-thyrotropin-releasing hormone (178-199)
- Preprothyrotropin-releasing hormone (178-199)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
