CAS 122018-93-3
:4-trifluoromethylcoumarin phosphate
Description:
4-Trifluoromethylcoumarin phosphate is a chemical compound characterized by its unique structure, which includes a coumarin moiety substituted with a trifluoromethyl group and a phosphate functional group. This compound typically exhibits properties associated with both coumarins and phosphates, such as fluorescence, making it useful in various applications, including biological imaging and as a fluorescent probe. The trifluoromethyl group enhances the lipophilicity and stability of the molecule, while the phosphate group can facilitate interactions with biological systems, potentially allowing for targeted delivery or activity in biochemical assays. Additionally, compounds like 4-trifluoromethylcoumarin phosphate may demonstrate interesting photophysical properties, including absorption and emission characteristics that can be tuned based on the surrounding environment. Its synthesis often involves multi-step organic reactions, and it may be utilized in research settings for studying cellular processes or as a tool in chemical biology. As with many fluorinated compounds, considerations regarding environmental impact and safety are essential during handling and disposal.
Formula:C10H6F3O6P
InChI:InChI=1/C10H6F3O6P/c11-10(12,13)7-4-9(14)18-8-3-5(1-2-6(7)8)19-20(15,16)17/h1-4H,(H2,15,16,17)
SMILES:c1cc2c(cc(=O)oc2cc1OP(=O)(O)O)C(F)(F)F
Synonyms:- 7-(Phosphonooxy)-4-(trifluoromethyl)-2H-1-benzopyran-2-one
- Hfcp
- 2H-1-Benzopyran-2-one, 7-(phosphonooxy)-4-(trifluoromethyl)-
- 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl dihydrogen phosphate
- 4-Trifluoromethylcoumarin phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-2-one, 7-(phosphonooxy)-4-(trifluoromethyl)-
CAS:Formula:C10H6F3O6PMolecular weight:310.12
