CymitQuimica logo

CAS 1220219-79-3

:

2-Fluoro-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine

Description:
2-Fluoro-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a fluorine atom, an amine group, and a boron-containing dioxaborolane moiety. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its electronic properties, making it potentially useful in various chemical reactions, including those in medicinal chemistry and materials science. The dioxaborolane group is known for its ability to participate in cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Additionally, the branched alkyl group (2-methylpropyl) contributes to the compound's steric properties, potentially affecting its solubility and interaction with biological systems. Overall, this compound's unique combination of functional groups suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C16H25BFNO2
InChI:InChI=1S/C16H25BFNO2/c1-11(2)10-19-14-9-12(7-8-13(14)18)17-20-15(3,4)16(5,6)21-17/h7-9,11,19H,10H2,1-6H3
InChI key:InChIKey=YWBALJDSKSPDOW-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(NCC(C)C)=C(F)C=C2
Synonyms:
  • Benzenamine, 2-fluoro-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 2-Fluoro-N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.