
CAS 122022-98-4
:3-Cyclopentene-1-carboxylic acid, 2-amino-
Description:
3-Cyclopentene-1-carboxylic acid, 2-amino- is an organic compound characterized by its cyclopentene ring structure, which features a carboxylic acid functional group and an amino group. This compound is a derivative of cyclopentene, a five-membered cyclic alkene, and its structure suggests it possesses both acidic and basic properties due to the presence of the carboxylic acid and amino groups, respectively. The carboxylic acid group contributes to its acidity, while the amino group can act as a base, allowing for potential interactions in various chemical environments. This compound may exhibit reactivity typical of both functional groups, such as undergoing esterification or amine reactions. Additionally, its cyclic structure may impart unique steric and electronic properties, influencing its behavior in biological systems or synthetic applications. Overall, 3-Cyclopentene-1-carboxylic acid, 2-amino- is a versatile compound with potential applications in organic synthesis and medicinal chemistry, although specific reactivity and stability would depend on the surrounding conditions.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c7-5-3-1-2-4(5)6(8)9/h1,3-5H,2,7H2,(H,8,9)
InChI key:InChIKey=NLCBWTXCWRLPIR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(N)C=CC1
Synonyms:- 3-Cyclopentene-1-carboxylic acid, 2-amino-
- 2-Aminocyclopent-3-ene-1-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
