CAS 122033-54-9
:4-Bromo-2,3,5,6-tetrafluorobenzoylchloride
Description:
4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride is an aromatic compound characterized by the presence of both bromine and multiple fluorine substituents on a benzene ring, along with a benzoyl chloride functional group. This compound features a bromine atom at the para position relative to the carbonyl group, while the tetrafluorobenzoyl moiety indicates that four fluorine atoms are attached to the benzene ring at the ortho and para positions. The presence of the acyl chloride functional group makes it reactive, particularly in nucleophilic acyl substitution reactions. This compound is typically used in organic synthesis, particularly in the preparation of fluorinated compounds and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Due to the presence of halogens, it may exhibit unique reactivity patterns and environmental considerations, particularly regarding its stability and potential toxicity.
Formula:C7BrClF4O
InChI:InChI=1/C7BrClF4O/c8-2-5(12)3(10)1(7(9)14)4(11)6(2)13
SMILES:c1(c(c(c(c(c1F)F)Br)F)F)C(=O)Cl
Synonyms:- 4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7BrClF4OPurity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:291.424-bromo-2,3,5,6-tetrafluorobenzoyl chloride
CAS:4-bromo-2,3,5,6-tetrafluorobenzoyl chlorideFormula:C7BrClF4OPurity:≥95%Color and Shape: clear. colourless liquidMolecular weight:291.42g/mol


