CymitQuimica logo

CAS 122035-41-0

:

Boronic acid, bicyclo[2.2.1]hept-2-yl-, exo-

Description:
Boronic acid, bicyclo[2.2.1]hept-2-yl-, exo- is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a bicyclic structure. This compound features a bicyclo[2.2.1]heptane framework, which consists of two bridged cyclopropane rings, providing unique steric and electronic properties. The "exo" designation indicates the orientation of the substituents relative to the bicyclic system, influencing its reactivity and interactions with other molecules. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis, medicinal chemistry, and materials science. They also play a crucial role in Suzuki coupling reactions, a widely used method for forming carbon-carbon bonds. The specific structure of this compound may impart distinct characteristics, such as solubility and stability, which can be influenced by the bicyclic nature and the positioning of the boronic acid group. Overall, this compound exemplifies the diverse chemistry of boron-containing compounds.
Formula:C7H13BO2
InChI:InChI=1/C7H13BO2/c9-8(10)7-4-5-1-2-6(7)3-5/h5-7,9-10H,1-4H2/t5-,6+,7+/s2
InChI key:InChIKey=WMEQUBSKQSETPY-YUZWJPFSNA-N
SMILES:B(O)(O)[C@H]1[C@]2(C[C@@](C1)(CC2)[H])[H]
Synonyms:
  • Boronic acid, bicyclo[2.2.1]hept-2-yl-, exo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.