CAS 1220422-12-7

Methyl 5-bromo-2-(methylthio)-3-pyridinecarboxylate

Description:

Methyl 5-bromo-2-(methylthio)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methylthio group at the 2-position contributes to its reactivity and potential applications in various chemical reactions. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents and may facilitate nucleophilic substitution reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its structural features suggest that it may exhibit biological activity, making it of interest for further research in medicinal chemistry. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts associated with halogenated organic substances.

Formula: C₈H₈BrNO₂S

InChI: InChI=1S/C8H8BrNO2S/c1-12-8(11)6-3-5(9)4-10-7(6)13-2/h3-4H,1-2H3

InChI key: InChIKey=FFKOQOWUJKHKAM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(SC)N=CC(Br)=C1

Synonyms:

• Methyl 5-bromo-2-(methylthio)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 5-bromo-2-(methylthio)-, methyl ester