CAS 1220518-04-6

2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine

Description:

2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of two chlorine atoms at the 2 and 4 positions contributes to its reactivity and potential biological activity. The cyclopropyl group at the 7 position introduces strain and can influence the compound's interaction with biological targets. This compound may exhibit properties such as moderate solubility in organic solvents and potential lipophilicity, which can affect its pharmacokinetics if used in medicinal chemistry. Its structural features suggest possible applications in drug development, particularly in targeting specific enzymes or receptors due to its ability to mimic natural substrates. Additionally, the presence of halogens often enhances the compound's stability and can influence its metabolic pathways. Overall, 2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine represents a class of compounds that may hold significance in pharmaceutical research and development.

Formula: C₉H₇Cl₂N₃

InChI: InChI=1S/C9H7Cl2N3/c10-7-6-3-4-14(5-1-2-5)8(6)13-9(11)12-7/h3-5H,1-2H2

InChI key: InChIKey=FWAVMANUFQKJFX-UHFFFAOYSA-N

SMILES: ClC1=C2C(N(C=C2)C3CC3)=NC(Cl)=N1

Synonyms:

• 2,4-Dichloro-7-cyclopropylpyrrolo[2,3-d]pyrimidine
• 2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine
• 7H-Pyrrolo[2,3-d]pyrimidine, 2,4-dichloro-7-cyclopropyl-

2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1220518-04-6

Formula: C₉H₇Cl₂N₃

Molecular weight: 228.0780

Ref: IN-DA00HGLQ

2,4-Dichloro-7-cyclopropyl-7H-pyrrolo[2,3-d]pyrimidine, 95%

CAS: 1220518-04-6

Formula: C₉H₇Cl₂N₃

Purity: 95%

Color and Shape: White Solid

Molecular weight: 228.08

Ref: 08-07-0205