CAS 1220518-10-4

6-Fluoropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

Description:

6-Fluoropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 6-position enhances its reactivity and may influence its biological activity. This compound typically exhibits a solid-state form and is soluble in polar organic solvents. Its structure includes two carbonyl groups, which are indicative of its diketone functionality, allowing for potential interactions in various chemical reactions. The compound may serve as a valuable intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to its ability to participate in nucleophilic substitutions and other transformations. Additionally, its unique electronic properties, influenced by the fluorine substituent, may impart specific characteristics that are beneficial in medicinal chemistry, such as improved binding affinity to biological targets. Overall, 6-Fluoropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is a compound of interest for further research and application in various chemical fields.

Formula: C₇H₄FN₃O₂

InChI: InChI=1S/C7H4FN3O2/c8-3-1-4-5(9-2-3)10-7(13)11-6(4)12/h1-2H,(H2,9,10,11,12,13)

InChI key: InChIKey=LAMMUQIWOZBYSL-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(=O)N1)=NC=C(F)C2

Synonyms:

• Pyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 6-fluoro-
• 6-Fluoropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione