CAS 122056-08-0
:1,1,1,3,3,3-HEXAFLUORO-2-(4-VINYLPHENYL)PROPAN-2-OL
Description:
1,1,1,3,3,3-Hexafluoro-2-(4-vinylphenyl)propan-2-ol, with the CAS number 122056-08-0, is a fluorinated organic compound characterized by its unique structure that includes a hexafluoroalkyl group and a vinylphenyl moiety. This compound is notable for its high thermal and chemical stability, attributed to the presence of fluorine atoms, which enhance its resistance to degradation. The hydroxyl group in its structure contributes to its potential as a solvent or reagent in various chemical reactions. Additionally, the vinyl group allows for further polymerization or cross-linking reactions, making it useful in materials science and polymer chemistry. Its properties may include low surface tension and high hydrophobicity, which can influence its behavior in different environments. The compound's applications may extend to fields such as coatings, adhesives, and specialty chemicals, where its unique characteristics can be leveraged for specific functionalities. Safety and handling considerations are essential due to the potential environmental and health impacts associated with fluorinated compounds.
Formula:C11H8F6O
InChI:InChI=1/C11H8F6O/c1-2-7-3-5-8(6-4-7)9(18,10(12,13)14)11(15,16)17/h2-6,18H,1H2
SMILES:C=Cc1ccc(cc1)C(C(F)(F)F)(C(F)(F)F)O
Synonyms:- 4-Hfa-St
- 1,1,1,3,3,3-Hexafluoro-2-(4-vinylphenyl)propan-2-ol 97%
- 1,1,1,3,3,3-Hexafluoro-2-(4-vinylphenyl)propan-2-ol97%
- 2-(4-Ethenylphenyl)-1,1,1,3,3,3-Hexafluoropropan-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
