CAS 122056-52-4

[Dichloro(2-phenylethynyl)silyl]benzene

Description:

[Dichloro(2-phenylethynyl)silyl]benzene, with the CAS number 122056-52-4, is an organosilicon compound characterized by the presence of a silicon atom bonded to two chlorine atoms and a phenylethynyl group. This compound typically exhibits a combination of organic and inorganic properties due to its silicon content. The presence of the phenylethynyl group contributes to its potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in the synthesis of more complex molecules. The dichloro substituents can influence its reactivity, making it a useful precursor in various chemical reactions, including cross-coupling reactions. Additionally, the compound's structure suggests potential applications in the field of electronics or photonics, where organosilicon compounds are often utilized for their unique electronic properties. Safety and handling considerations are important, as the chlorine atoms can pose hazards, necessitating appropriate precautions during use. Overall, [Dichloro(2-phenylethynyl)silyl]benzene is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₄H₁₀Cl₂Si

InChI: InChI=1S/C14H10Cl2Si/c15-17(16,14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H

InChI key: InChIKey=ZJOQBZXGTHEVKQ-UHFFFAOYSA-N

SMILES: [Si](C#CC1=CC=CC=C1)(Cl)(Cl)C2=CC=CC=C2

Synonyms:

• Dichloro(phenyl)(phenylethynyl)silane
• Silane, dichlorophenyl(phenylethynyl)-
• Benzene, [dichloro(2-phenylethynyl)silyl]-
• [Dichloro(2-phenylethynyl)silyl]benzene

Benzene, [dichloro(2-phenylethynyl)silyl]-

CAS: 122056-52-4

Formula: C₁₄H₁₀Cl₂Si

Molecular weight: 277.2207

Ref: IN-DA0016OG