CAS 1220616-46-5: Rebaudioside N
Description:Rebaudioside N is a natural sweetener derived from the leaves of the Stevia rebaudiana plant, which is known for its high sweetness intensity compared to sucrose. It belongs to a class of compounds known as steviol glycosides, which are responsible for the sweet taste of stevia. Rebaudioside N is characterized by its low caloric content, making it an attractive alternative to traditional sugars for those seeking to reduce caloric intake. It is stable under heat and acidic conditions, which allows it to be used in various food and beverage applications without losing its sweetness. Additionally, Rebaudioside N has a clean taste profile, with minimal aftertaste compared to some other steviol glycosides. Its safety for consumption has been evaluated, and it is generally recognized as safe (GRAS) by food safety authorities. As a non-nutritive sweetener, Rebaudioside N is increasingly popular in the food industry, particularly in products aimed at health-conscious consumers.
Formula:C56H90O32
InChI:InChI=1S/C56H90O32/c1-19-12-55-10-6-26-53(3,8-5-9-54(26,4)52(76)87-50-44(85-46-38(72)34(68)28(62)20(2)77-46)42(32(66)24(16-60)81-50)83-47-39(73)35(69)29(63)21(13-57)78-47)27(55)7-11-56(19,18-55)88-51-45(86-49-41(75)37(71)31(65)23(15-59)80-49)43(33(67)25(17-61)82-51)84-48-40(74)36(70)30(64)22(14-58)79-48/h20-51,57-75H,1,5-18H2,2-4H3/t20-,21+,22+,23+,24+,25+,26-,27-,28-,29+,30+,31+,32+,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,44+,45+,46-,47-,48-,49-,50-,51-,53+,54+,55+,56-/m0/s1
InChI key:InChIKey=AKEKAGBWNXIWSS-ZFXKUSSPSA-N
SMILES:O=C(OC1OC(CO)C(O)C(OC2OC(CO)C(O)C(O)C2O)C1OC3OC(C)C(O)C(O)C3O)C4(C)CCCC5(C)C4CCC67CC(=C)C(OC8OC(CO)C(O)C(OC9OC(CO)C(O)C(O)C9O)C8OC%10OC(CO)C(O)C(O)C%10O)(CCC65)C7
- Synonyms:
- Kaur-16-en-18-oic acid, 13-[(O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl)oxy]-, O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl ester, (4α)-
- Rebaudioside N