CAS 1220616-46-5
:Rebaudioside N
Description:
Rebaudioside N is a natural sweetener derived from the leaves of the Stevia rebaudiana plant, which is known for its high sweetness intensity compared to sucrose. It belongs to a class of compounds known as steviol glycosides, which are responsible for the sweet taste of stevia. Rebaudioside N is characterized by its low caloric content, making it an attractive alternative to traditional sugars for those seeking to reduce caloric intake. It is stable under heat and acidic conditions, which allows it to be used in various food and beverage applications without losing its sweetness. Additionally, Rebaudioside N has a clean taste profile, with minimal aftertaste compared to some other steviol glycosides. Its safety for consumption has been evaluated, and it is generally recognized as safe (GRAS) by food safety authorities. As a non-nutritive sweetener, Rebaudioside N is increasingly popular in the food industry, particularly in products aimed at health-conscious consumers.
Formula:C56H90O32
InChI:InChI=1S/C56H90O32/c1-19-12-55-10-6-26-53(3,8-5-9-54(26,4)52(76)87-50-44(85-46-38(72)34(68)28(62)20(2)77-46)42(32(66)24(16-60)81-50)83-47-39(73)35(69)29(63)21(13-57)78-47)27(55)7-11-56(19,18-55)88-51-45(86-49-41(75)37(71)31(65)23(15-59)80-49)43(33(67)25(17-61)82-51)84-48-40(74)36(70)30(64)22(14-58)79-48/h20-51,57-75H,1,5-18H2,2-4H3/t20-,21+,22+,23+,24+,25+,26-,27-,28-,29+,30+,31+,32+,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,44+,45+,46-,47-,48-,49-,50-,51-,53+,54+,55+,56-/m0/s1
InChI key:InChIKey=AKEKAGBWNXIWSS-ZFXKUSSPSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@](O[C@H]5[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@@H](CO)O5)(C(=C)C4)CC3)CC[C@@]1([C@@](C(O[C@H]8[C@H](O[C@H]9[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O9)[C@@H](O[C@@H]%10O[C@H](CO)[C@@H](O)[C@H](O)[C@H]%10O)[C@H](O)[C@@H](CO)O8)=O)(C)CCC2)[H])[H]
Synonyms:- Kaur-16-en-18-oic acid, 13-[(O-β-D-glucopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl)oxy]-, O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→3)]-β-D-glucopyranosyl ester, (4α)-
- Rebaudioside N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Rebaudioside N
CAS:Rebaudioside N is a steviol glycoside isolated from the leaves of Stevia rebaudiana and is used as a food additive.Formula:C56H90O32Purity:98.26%Color and Shape:SolidMolecular weight:1275.29Rebaudioside N
CAS:Formula:C56H90O32Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white powderMolecular weight:1275.30Rebaudioside n
CAS:Natural glycosideFormula:C56H90O32Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:1275.31Rebaudioside N
CAS:Rebaudioside N is a naturally occurring steviol glycoside, which is a type of molecule known for its sweetening properties. This compound is sourced from the leaves of the Stevia rebaudiana plant, a species native to South America renowned for its natural sweetness due to the presence of various glycosides. Rebaudioside N and other similar compounds are part of a broader category of non-caloric sweeteners that have gained attention due to their desirable taste profiles and natural origin.Formula:C56H90O32Purity:Min. 95%Molecular weight:1,275.29 g/mol






