CAS 1220631-43-5

6,8-Dichloroimidazo[1,2-b]pyridazine-3-carboxamide

Description:

6,8-Dichloroimidazo[1,2-b]pyridazine-3-carboxamide is a heterocyclic compound characterized by its imidazo and pyridazine ring systems, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 6 and 8 positions of the imidazo ring, enhancing its reactivity and potential biological activity. The carboxamide functional group at the 3-position plays a crucial role in its solubility and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The presence of halogens often influences the compound's lipophilicity and metabolic stability. Additionally, the structural complexity of 6,8-Dichloroimidazo[1,2-b]pyridazine-3-carboxamide may allow for diverse interactions with biomolecules, making it a subject of interest in drug discovery and development. As with many chemical substances, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₇H₄Cl₂N₄O

InChI: InChI=1S/C7H4Cl2N4O/c8-3-1-5(9)12-13-4(6(10)14)2-11-7(3)13/h1-2H,(H2,10,14)

InChI key: InChIKey=GFRSPRRTFVGJFK-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1N2C(=NC1)C(Cl)=CC(Cl)=N2

Synonyms:

• 6,8-Dichloroimidazo[1,2-b]pyridazine-3-carboxamide
• Imidazo[1,2-b]pyridazine-3-carboxamide, 6,8-dichloro-