CAS 1220669-36-2

9H-Fluoren-9-ylmethyl (3S)-3-amino-1-pyrrolidinecarboxylate

Description:

9H-Fluoren-9-ylmethyl (3S)-3-amino-1-pyrrolidinecarboxylate is a chemical compound characterized by its unique structure, which includes a fluorenylmethyl group and a pyrrolidine ring with an amino and carboxylate functional group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the amino group suggests it may participate in various chemical reactions, including peptide bond formation, while the carboxylate group can engage in ionic interactions. The fluorenylmethyl moiety contributes to the compound's hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. Additionally, the stereochemistry indicated by the (3S) designation suggests that the compound has specific spatial arrangements that may affect its pharmacological properties. Overall, this compound's structural features make it a subject of interest for research in drug development and synthetic methodologies.

Formula: C₁₉H₂₀N₂O₂

InChI: InChI=1S/C19H20N2O2/c20-13-9-10-21(11-13)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12,20H2/t13-/m0/s1

InChI key: InChIKey=BCWKNNDZLLBHEG-ZDUSSCGKSA-N

SMILES: C(OC(=O)N1CC[C@H](N)C1)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-amino-, 9H-fluoren-9-ylmethyl ester, (3S)-
• 9H-Fluoren-9-ylmethyl (3S)-3-amino-1-pyrrolidinecarboxylate
• (s)-1-Fmoc-3-aminopyrrolidine