
CAS 122069-63-0
:(5Z,7E,9E,11R,12S)-11-[[(2R)-2-Amino-2-carboxyethyl]thio]-12-hydroxy-5,7,9-hexadecatrienedioic acid
Description:
The chemical substance known as (5Z,7E,9E,11R,12S)-11-[[(2R)-2-Amino-2-carboxyethyl]thio]-12-hydroxy-5,7,9-hexadecatrienedioic acid, with the CAS number 122069-63-0, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a long hydrocarbon chain with multiple double bonds, indicating it is a polyunsaturated fatty acid derivative. The presence of both amino and carboxylic acid functional groups suggests that it may exhibit properties typical of amino acids, such as solubility in water and potential for forming peptide bonds. The thiol group (-SH) indicates reactivity, allowing for potential interactions with other biomolecules. This compound is likely to play a role in biological systems, possibly as a signaling molecule or a precursor in metabolic pathways. Its specific stereochemistry (designated by the R and S configurations) is crucial for its biological activity, influencing how it interacts with enzymes and receptors in living organisms. Overall, this substance is of interest in biochemical research and may have implications in fields such as pharmacology and nutrition.
Formula:C19H29NO7S
InChI:InChI=1S/C19H29NO7S/c20-14(19(26)27)13-28-16(15(21)9-8-12-18(24)25)10-6-4-2-1-3-5-7-11-17(22)23/h1-4,6,10,14-16,21H,5,7-9,11-13,20H2,(H,22,23)(H,24,25)(H,26,27)/b3-1-,4-2+,10-6+/t14-,15-,16+/m0/s1
InChI key:InChIKey=LDJCPGIDJQSRGG-XFJBKEMKSA-N
SMILES:[C@H](SC[C@@H](C(O)=O)N)([C@H](CCCC(O)=O)O)/C=C/C=C/C=C\CCCC(O)=O
Synonyms:- 5,7,9-Hexadecatrienedioic acid, 11-[[(2R)-2-amino-2-carboxyethyl]thio]-12-hydroxy-, (5Z,7E,9E,11R,12S)-
- 5,7,9-Hexadecatrienedioic acid, 11-[(2-amino-2-carboxyethyl)thio]-12-hydroxy-, [11R-[5Z,7E,9E,11R*(R*),12S*]]-
- (5Z,7E,9E,11R,12S)-11-[[(2R)-2-Amino-2-carboxyethyl]thio]-12-hydroxy-5,7,9-hexadecatrienedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,7,9-Hexadecatrienedioic acid, 11-[[(2R)-2-amino-2-carboxyethyl]thio]-12-hydroxy-, (5Z,7E,9E,11R,12S)-
CAS:Formula:C19H29NO7SMolecular weight:415.5011
