CAS 1220696-49-0
:3-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the ethyl group at the 3-position and the boron-containing dioxaborolane moiety at the 5-position contributes to its unique chemical properties. The dioxaborolane structure is notable for its ability to form stable complexes with various substrates, making this compound potentially useful in organic synthesis and catalysis. The tetramethyl substitution enhances the steric bulk around the boron atom, which can influence reactivity and selectivity in chemical reactions. This compound may exhibit solubility in organic solvents and could participate in various chemical transformations, including cross-coupling reactions, due to the presence of the boron atom. Its specific applications would depend on its reactivity profile and compatibility with other reagents in synthetic pathways. Overall, this compound represents a versatile building block in the field of organic chemistry.
Formula:C13H20BNO2
InChI:InChI=1S/C13H20BNO2/c1-6-10-7-11(9-15-8-10)14-16-12(2,3)13(4,5)17-14/h7-9H,6H2,1-5H3
InChI key:InChIKey=HORWYTDAFKMPER-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(CC)C=NC2
Synonyms:- 3-Ethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 3-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
