
CAS 122078-09-5
:Benzenemethanamine, 2,3,4-trimethoxy-α-methyl-, (S)-
Description:
Benzenemethanamine, 2,3,4-trimethoxy-α-methyl-, (S)-, also known by its CAS number 122078-09-5, is a chiral organic compound characterized by its complex structure featuring a benzene ring substituted with a methanamine group and multiple methoxy groups. The presence of the trimethoxy substituents at the 2, 3, and 4 positions of the benzene ring enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The α-methyl group contributes to its stereochemistry, making it a specific enantiomer with potential applications in pharmaceuticals or as a biochemical probe. This compound may exhibit properties such as moderate to high polarity due to the methoxy groups, and its amine functionality can participate in hydrogen bonding, affecting its physical and chemical behavior. Additionally, the compound's chirality may play a significant role in its biological activity, making it of interest in medicinal chemistry and drug development.
Formula:C11H17NO3
InChI:InChI=1S/C11H17NO3/c1-7(12)8-5-6-9(13-2)11(15-4)10(8)14-3/h5-7H,12H2,1-4H3/t7-/m0/s1
InChI key:InChIKey=PKLNPKXFQTWPOI-ZETCQYMHSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC=C1[C@H](C)N
Synonyms:- (1S)-1-(2,3,4-Trimethoxyphenyl)ethanamine
- Benzenemethanamine, 2,3,4-trimethoxy-α-methyl-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.