CAS 1220887-84-2
:(1R,4R,5R)-4-[4-(1,1-Dimethylheptyl)-2,6-dimethoxyphenyl]-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-methanol
Description:
The chemical substance known as "(1R,4R,5R)-4-[4-(1,1-Dimethylheptyl)-2,6-dimethoxyphenyl]-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-methanol" with CAS number 1220887-84-2 is a complex organic compound characterized by its bicyclic structure and multiple functional groups. It features a bicyclo[3.1.1]heptene core, which contributes to its unique three-dimensional shape and potential steric interactions. The presence of a methanol group indicates that it has hydroxyl functionality, which can influence its solubility and reactivity. Additionally, the compound contains a dimethoxyphenyl moiety and a branched alkyl chain (1,1-dimethylheptyl), suggesting that it may exhibit hydrophobic properties and potentially interact with biological systems. The stereochemistry, indicated by the (1R,4R,5R) configuration, suggests specific spatial arrangements that could affect its biological activity and interactions with receptors. Overall, this compound may have applications in medicinal chemistry or materials science, although specific biological or chemical properties would require further investigation.
Formula:C27H42O3
InChI:InChI=1S/C27H42O3/c1-8-9-10-11-12-26(2,3)19-14-23(29-6)25(24(15-19)30-7)20-13-18(17-28)21-16-22(20)27(21,4)5/h13-15,20-22,28H,8-12,16-17H2,1-7H3/t20-,21+,22-/m1/s1
InChI key:InChIKey=CFMRIVODIXTERW-BHIFYINESA-N
SMILES:O(C)C1=C([C@H]2[C@@]3(C(C)(C)[C@@](C3)(C(CO)=C2)[H])[H])C(OC)=CC(C(CCCCCC)(C)C)=C1
Synonyms:- Bicyclo[3.1.1]hept-2-ene-2-methanol, 4-[4-(1,1-dimethylheptyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-, (1R,4R,5R)-
- (1R,4R,5R)-4-[4-(1,1-Dimethylheptyl)-2,6-dimethoxyphenyl]-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-methanol
- HU 433
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
HU 433
CAS:Controlled Product<p>HU 433 is an analog that has shown potent anticancer properties. It is a kinase inhibitor that targets specific proteins involved in cancer cell growth and survival. HU 433 induces apoptosis, or programmed cell death, in human cancer cells. This compound has been tested extensively in Chinese hamster ovary cells and has shown to be effective against a variety of tumor types. HU 433 inhibits the activity of kinases involved in protein synthesis and cellular signaling pathways, leading to the suppression of tumor growth. This compound has also been formulated with chitosan for improved delivery and bioavailability. HU 433 may hold promise as a potential cancer therapy due to its ability to selectively target cancer cells while sparing healthy tissue.</p>Formula:C27H42O3Purity:Min. 95%Color and Shape:PowderMolecular weight:414.6 g/molHU 433
CAS:<p>HU 433, a synthetic cannabinoid, acts as a CB2 receptor agonist and is an enantiomer of HU 308. It provides anti-inflammatory and neuroprotective effects by binding to the CB2 receptor, primarily found on immune cells, thereby modulating immune responses and inflammation. Additionally, HU 433 influences microglial signaling pathways, particularly LPS and IFNγ-mediated routes, affecting the phosphorylation of MAPKs, including ERK1/2, JNK, p38, and Akt. This compound is valuable in researching neuroinflammation and retinal diseases.</p>Formula:C27H42O3Color and Shape:SolidMolecular weight:414.62


