
CAS 122090-09-9
:1-Methyl-3-[(1R)-1,2,2-trimethylcyclopentyl]benzene
Description:
1-Methyl-3-[(1R)-1,2,2-trimethylcyclopentyl]benzene, identified by its CAS number 122090-09-9, is an organic compound characterized by its complex structure, which includes a methyl group and a substituted cyclopentyl moiety attached to a benzene ring. This compound belongs to the class of alkylated benzenes, which are known for their hydrophobic properties and potential applications in various chemical processes. The presence of the trimethylcyclopentyl group contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. Typically, such compounds exhibit moderate volatility and can be found in various industrial applications, including as solvents or intermediates in organic synthesis. Additionally, the specific stereochemistry indicated by the (1R) configuration suggests that the compound may exhibit unique physical and chemical properties, such as distinct boiling and melting points, as well as specific interactions in biological systems. Overall, the characteristics of this compound make it of interest in both synthetic chemistry and potential applications in materials science.
Formula:C15H22
InChI:InChI=1S/C15H22/c1-12-7-5-8-13(11-12)15(4)10-6-9-14(15,2)3/h5,7-8,11H,6,9-10H2,1-4H3/t15-/m0/s1
InChI key:InChIKey=BBZBREYBGRYINI-HNNXBMFYSA-N
SMILES:C[C@@]1(C(C)(C)CCC1)C2=CC(C)=CC=C2
Synonyms:- (+)-Herbertene
- Benzene, 1-methyl-3-(1,2,2-trimethylcyclopentyl)-, (R)-
- Benzene, 1-methyl-3-[(1R)-1,2,2-trimethylcyclopentyl]-
- 1-Methyl-3-[(1R)-1,2,2-trimethylcyclopentyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
