CymitQuimica logo

CAS 122092-18-6

:

N-(4-Nitrophenyl)-L-proline

Description:
N-(4-Nitrophenyl)-L-proline is an organic compound characterized by its proline backbone, which is an amino acid, modified with a nitrophenyl group at the nitrogen atom. This compound typically exhibits a yellow crystalline appearance due to the presence of the nitro group, which can influence its solubility and reactivity. It is known for its potential applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals. The nitro group can participate in electrophilic aromatic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the proline structure may impart unique conformational properties, affecting its biological activity and interactions with other molecules. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of solvents. Overall, N-(4-Nitrophenyl)-L-proline serves as an important compound in research, particularly in the fields of drug development and organic synthesis.
Formula:C11H12N2O4
InChI:InChI=1/C11H12N2O4/c14-11(15)10-2-1-7-12(10)8-3-5-9(6-4-8)13(16)17/h3-6,10H,1-2,7H2,(H,14,15)/t10-/m0/s1
SMILES:C1C[C@@H](C(=O)O)N(C1)c1ccc(cc1)N(=O)=O
Synonyms:
  • 122092-18-6
  • 1-(4-nitrophenyl)-L-proline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.