CAS 122111-08-4: D-threo-Pentonic acid, 2-deoxy-2,2-difluoro-, γ-lactone, 3-benzoate

Description:D-threo-Pentonic acid, 2-deoxy-2,2-difluoro-, γ-lactone, 3-benzoate, identified by CAS number 122111-08-4, is a synthetic organic compound characterized by its unique structural features. This compound is a derivative of pentonic acid, which is a five-carbon sugar acid, and it contains a lactone functional group, indicating a cyclic ester formation. The presence of two fluorine atoms in the 2-deoxy position suggests enhanced stability and potential biological activity, as fluorinated compounds often exhibit altered reactivity and pharmacokinetics. The benzoate moiety indicates that the compound has been esterified with benzoic acid, which can influence its solubility and interaction with biological systems. Overall, this compound may possess interesting properties for research in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe, although specific biological activities and applications would require further investigation.

Formula:C₁₂H₁₀F₂O₅

InChI:InChI=1S/C12H10F2O5/c13-12(14)9(8(6-15)18-11(12)17)19-10(16)7-4-2-1-3-5-7/h1-5,8-9,15H,6H2/t8-,9+/m1/s1

InChI key:InChIKey=BIFWGBBUNCUGII-BDAKNGLRSA-N

SMILES:O=C(OC1C(OC(=O)C1(F)F)CO)C=2C=CC=CC2