CAS 122115-49-5
:ethyl 7-oxo-7-(p-tolyl)heptanoate
Description:
Ethyl 7-oxo-7-(p-tolyl)heptanoate, with the CAS number 122115-49-5, is an organic compound characterized by its ester functional group and a ketone moiety. It features a heptanoate backbone, which consists of a seven-carbon chain, and a p-tolyl group, indicating the presence of a para-substituted methylphenyl group. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. Its molecular structure suggests it may exhibit moderate polarity due to the ester and ketone functionalities, influencing its solubility in various organic solvents. Ethyl 7-oxo-7-(p-tolyl)heptanoate may also participate in various chemical reactions, such as nucleophilic additions or condensation reactions, due to the reactivity of the carbonyl groups. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals.
Formula:C16H22O3
InChI:InChI=1/C16H22O3/c1-3-19-16(18)8-6-4-5-7-15(17)14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccc(C)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.