CymitQuimica logo

CAS 1221153-79-2

:

5-Chloro-1-(1-methylethyl)-1H-pyrrolo[2,3-c]pyridine

Description:
5-Chloro-1-(1-methylethyl)-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 5-position and an isopropyl group at the 1-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine and pyrrole moieties, which are often associated with various biological activities. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis.
Formula:C10H11ClN2
InChI:InChI=1S/C10H11ClN2/c1-7(2)13-4-3-8-5-10(11)12-6-9(8)13/h3-7H,1-2H3
InChI key:InChIKey=LZAVVXYESLVJMB-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(C=C1)=CC(Cl)=NC2
Synonyms:
  • 5-Chloro-1-(1-methylethyl)-1H-pyrrolo[2,3-c]pyridine
  • 1H-Pyrrolo[2,3-c]pyridine, 5-chloro-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.