CymitQuimica logo

CAS 1221158-40-2

:

1,5,6-Trideoxy-4-O-β-D-glucopyranosyl-1-[[(1S,4R,5R,6S)-4-(α-D-glucopyranosyloxy)-5,6-dihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-5-(hydroxymethyl)-D-chiro-inositol

Description:
1,5,6-Trideoxy-4-O-β-D-glucopyranosyl-1-[[(1S,4R,5R,6S)-4-(α-D-glucopyranosyloxy)-5,6-dihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-5-(hydroxymethyl)-D-chiro-inositol is a complex organic compound characterized by its intricate molecular structure, which includes multiple sugar moieties and a cyclohexene ring. This substance features a combination of hydroxymethyl and amino functional groups, contributing to its potential biological activity. The presence of glucopyranosyl units suggests that it may interact with biological systems, possibly influencing metabolic pathways or serving as a signaling molecule. Its stereochemistry, indicated by the specific configuration of its chiral centers, is crucial for its biological function and interaction with enzymes or receptors. The compound's solubility and stability are likely influenced by its polar hydroxyl groups and glycosidic linkages. Overall, this substance may have applications in biochemistry or pharmacology, particularly in studies related to carbohydrate chemistry or medicinal chemistry, although specific biological activities would require further investigation.
Formula:C26H45NO18
InChI:InChI=1S/C26H45NO18/c28-3-7-1-9(13(32)19(38)23(7)44-25-21(40)17(36)15(34)11(5-30)42-25)27-10-2-8(4-29)24(20(39)14(10)33)45-26-22(41)18(37)16(35)12(6-31)43-26/h1,8-41H,2-6H2/t8-,9+,10+,11-,12-,13+,14+,15-,16-,17+,18+,19-,20-,21-,22-,23-,24-,25-,26+/m1/s1
InChI key:InChIKey=BAMUIMOYKPLBDW-LCCHZKSHSA-N
SMILES:O([C@@H]1[C@@H](CO)C[C@H](N[C@H]2C=C(CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:
  • Validamycin F
  • D-chiro-Inositol, 1,5,6-trideoxy-4-O-β-D-glucopyranosyl-1-[[(1S,4R,5R,6S)-4-(α-D-glucopyranosyloxy)-5,6-dihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-5-(hydroxymethyl)-
  • 1,5,6-Trideoxy-4-O-β-D-glucopyranosyl-1-[[(1S,4R,5R,6S)-4-(α-D-glucopyranosyloxy)-5,6-dihydroxy-3-(hydroxymethyl)-2-cyclohexen-1-yl]amino]-5-(hydroxymethyl)-D-chiro-inositol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.