CymitQuimica logo

CAS 1221171-78-3

:

2-Chloro-3-(trifluoromethoxy)-4-pyridinecarboxylic acid

Description:
2-Chloro-3-(trifluoromethoxy)-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the second position and a trifluoromethoxy group at the third position of the pyridine ring, along with a carboxylic acid functional group at the fourth position. The presence of the trifluoromethoxy group imparts significant polarity and potential reactivity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the trifluoromethoxy group may enhance its lipophilicity. Additionally, the chlorine atom can influence the compound's reactivity and stability. Overall, this compound's unique functional groups contribute to its potential utility in synthetic chemistry and medicinal applications.
Formula:C7H3ClF3NO3
InChI:InChI=1S/C7H3ClF3NO3/c8-5-4(15-7(9,10)11)3(6(13)14)1-2-12-5/h1-2H,(H,13,14)
InChI key:InChIKey=VDRKFHVMHAHSHY-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C(C(O)=O)=CC=NC1Cl
Synonyms:
  • 2-Chloro-3-(trifluoromethoxy)isonicotinic acid
  • 4-Pyridinecarboxylic acid, 2-chloro-3-(trifluoromethoxy)-
  • 2-Chloro-3-(trifluoromethoxy)-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.