CAS 1221172-02-6: 6-Chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine
Description:6-Chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 6-position and a trifluoromethoxy group at the 2-position contributes to its unique reactivity and polarity. Additionally, the trimethylsilyl group at the 3-position enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in nucleophilic substitution reactions and other transformations. Its trifluoromethoxy group can also influence the electronic properties of the molecule, potentially affecting its biological activity. As with many halogenated compounds, it is important to handle this substance with care, considering its potential environmental and health impacts.
Formula:C9H11ClF3NOSi
InChI:InChI=1S/C9H11ClF3NOSi/c1-16(2,3)6-4-5-7(10)14-8(6)15-9(11,12)13/h4-5H,1-3H3
InChI key:InChIKey=PGNOZXVLSUNTDC-UHFFFAOYSA-N
SMILES:FC(F)(F)OC1=NC(Cl)=CC=C1[Si](C)(C)C
- Synonyms:
- 2-Chloro-6-(trifluoromethoxy)-5-(trimethylsilyl)pyridine
- [6-Chloro-2-(trifluoromethoxy)pyridin-3-yl]-trimethylsilane
- 6-Chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine
- Pyridine, 6-chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Pyridine, 6-chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)- REF: IN-DA0016SUCAS: 1221172-02-6 | 95% | To inquire | Wed 05 Mar 25 |
![]() | 6-Chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine REF: 10-F723669CAS: 1221172-02-6 | 95+% | - - - | Discontinued product |
![]() | 6-chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine REF: 3D-WYB17202CAS: 1221172-02-6 | Min. 95% | - - - | Discontinued product |

Pyridine, 6-chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)-
Ref: IN-DA0016SU
1g | To inquire | ||
250mg | 311.00 € |

6-Chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine
Ref: 10-F723669
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

6-chloro-2-(trifluoromethoxy)-3-(trimethylsilyl)pyridine
Ref: 3D-WYB17202
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |