CAS 1221272-82-7

1-Chloro-3-(difluoromethyl)-2,4-difluorobenzene

Description:

1-Chloro-3-(difluoromethyl)-2,4-difluorobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple halogen atoms. Specifically, it features a chlorine atom and two fluorine atoms on the benzene ring, along with a difluoromethyl group (-CF2H) attached to the third carbon of the ring. This compound is typically colorless to pale yellow in appearance and may exhibit a distinct odor. Its molecular structure contributes to its chemical reactivity, making it useful in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of multiple electronegative fluorine and chlorine atoms enhances its polarity and can influence its solubility in organic solvents. Additionally, the compound's stability and reactivity can be affected by the arrangement of substituents on the benzene ring, which may impact its behavior in chemical reactions. Safety precautions should be taken when handling this substance due to its potential toxicity and environmental impact.

Formula: C₇H₃ClF₄

InChI: InChI=1S/C7H3ClF4/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2,7H

InChI key: InChIKey=GCPQAOPMSUCXSO-UHFFFAOYSA-N

SMILES: C(F)(F)C1=C(F)C(Cl)=CC=C1F

Synonyms:

• Benzene, 1-chloro-3-(difluoromethyl)-2,4-difluoro-
• 1-Chloro-3-(difluoromethyl)-2,4-difluorobenzene

1-Chloro-3-(difluoromethyl)-2,4-difluorobenzene

CAS: 1221272-82-7

Formula: C₇H₃ClF₄

Purity: 95.0%

Molecular weight: 198.54

Ref: 10-F440259