CAS 122130-63-6
:S-Nitrosocaptopril
Description:
S-Nitrosocaptopril is a chemical compound that is a derivative of captopril, an angiotensin-converting enzyme (ACE) inhibitor used primarily in the treatment of hypertension and heart failure. This compound is characterized by the presence of a nitroso group (-NO) attached to the sulfur atom of captopril, which is believed to enhance its pharmacological properties. S-Nitrosocaptopril exhibits vasodilatory effects, potentially offering therapeutic benefits in cardiovascular diseases. It is known for its ability to release nitric oxide (NO), a signaling molecule that plays a crucial role in vascular relaxation and blood pressure regulation. The compound is typically studied for its potential applications in improving cardiovascular function and its role in modulating oxidative stress. Additionally, S-Nitrosocaptopril may possess antioxidant properties, contributing to its protective effects against cellular damage. As with many nitrosated compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in research and clinical settings.
Formula:C9H14N2O4S
InChI:InChI=1S/C9H14N2O4S/c1-6(5-16-10-15)8(12)11-4-2-3-7(11)9(13)14/h6-7H,2-5H2,1H3,(H,13,14)/t6-,7+/m1/s1
InChI key:InChIKey=HNIULCDUASSKOM-RQJHMYQMSA-N
SMILES:C([C@@H](CSN=O)C)(=O)N1[C@H](C(O)=O)CCC1
Synonyms:- 1-[(2S)-2-Methyl-3-(nitrosothio)-1-oxopropyl]-<span class="text-smallcaps">L</span>-proline
- 1-[(2S)-2-methyl-3-(nitrososulfanyl)propanoyl]-L-proline
- <span class="text-smallcaps">L</span>-Proline, 1-[(2S)-2-methyl-3-(nitrosothio)-1-oxopropyl]-
- <span class="text-smallcaps">L</span>-Proline, 1-[2-methyl-3-(nitrosothio)-1-oxopropyl]-, (S)-
- S-Nitrosocaptopril
- 1-[(2S)-2-Methyl-3-(nitrosothio)-1-oxopropyl]-L-proline
- L-Proline, 1-[2-methyl-3-(nitrosothio)-1-oxopropyl]-, (S)-
- L-Proline, 1-[(2S)-2-methyl-3-(nitrosothio)-1-oxopropyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
L-Proline, 1-[(2S)-2-methyl-3-(nitrosothio)-1-oxopropyl]-
CAS:Formula:C9H14N2O4SColor and Shape:SolidMolecular weight:246.2835


