CAS 1221341-42-9

1,1-Dimethylethyl 2-methyl-3-[[3-(4-morpholinyl)propyl]amino]propanoate

Description:

1,1-Dimethylethyl 2-methyl-3-[[3-(4-morpholinyl)propyl]amino]propanoate, identified by its CAS number 1221341-42-9, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a morpholine moiety, and an amino acid derivative. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of various functional groups, making it potentially useful in pharmaceutical applications. Its molecular structure suggests it may interact with biological systems, possibly acting as a ligand or a precursor in synthetic pathways. The morpholine ring contributes to its potential biological activity, while the amino and ester functionalities may influence its solubility and reactivity. As with many organic compounds, its stability, reactivity, and biological effects would depend on environmental conditions such as pH and temperature. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₅H₃₀N₂O₃

InChI: InChI=1S/C15H30N2O3/c1-13(14(18)20-15(2,3)4)12-16-6-5-7-17-8-10-19-11-9-17/h13,16H,5-12H2,1-4H3

InChI key: InChIKey=JBJFBZHMKBAIFI-UHFFFAOYSA-N

SMILES: C(CCNCC(C(OC(C)(C)C)=O)C)N1CCOCC1

Synonyms:

• Propanoic acid, 2-methyl-3-[[3-(4-morpholinyl)propyl]amino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-methyl-3-[[3-(4-morpholinyl)propyl]amino]propanoate

tert-butyl 2-methyl-3-{[3-(morpholin-4-yl)propyl]amino}propanoate

CAS: 1221341-42-9

Formula: C₁₅H₃₀N₂O₃

Purity: 95.0%

Molecular weight: 286.416

Ref: 10-F522816