CAS 1221342-60-4

1-(3-Ethoxypropyl)-2-(methylsulfonyl)-1H-imidazole-5-methanol

Description:

1-(3-Ethoxypropyl)-2-(methylsulfonyl)-1H-imidazole-5-methanol, identified by its CAS number 1221342-60-4, is a chemical compound that belongs to the imidazole class of heterocyclic compounds. This substance features a complex structure characterized by the presence of an imidazole ring, which is a five-membered aromatic ring containing two nitrogen atoms. The compound also contains a methylsulfonyl group, which contributes to its potential reactivity and solubility properties. The ethoxypropyl group enhances its hydrophobic characteristics, while the methanol moiety may influence its polarity and solubility in various solvents. Such structural features suggest that this compound could exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Additionally, the presence of functional groups like the sulfonyl and hydroxymethyl may allow for further chemical modifications, potentially leading to derivatives with enhanced efficacy or selectivity in biological systems. Overall, this compound's unique structure positions it as a subject of interest in medicinal chemistry and related fields.

Formula: C₁₀H₁₈N₂O₄S

InChI: InChI=1S/C10H18N2O4S/c1-3-16-6-4-5-12-9(8-13)7-11-10(12)17(2,14)15/h7,13H,3-6,8H2,1-2H3

InChI key: InChIKey=XZNBUFDPMZCSRJ-UHFFFAOYSA-N

SMILES: C(CCOCC)N1C(S(C)(=O)=O)=NC=C1CO

Synonyms:

• 1H-Imidazole-5-methanol, 1-(3-ethoxypropyl)-2-(methylsulfonyl)-
• 1-(3-Ethoxypropyl)-2-(methylsulfonyl)-1H-imidazole-5-methanol

[1-(3-ethoxypropyl)-2-methanesulfonyl-1H-imidazol-5-yl]methanol

CAS: 1221342-60-4

Formula: C₁₀H₁₈N₂O₄S

Purity: 95.0%

Molecular weight: 262.32

Ref: 10-F523440