CymitQuimica logo

CAS 122142-15-8

:

4-Methyl-2-nitro-1-(2,2,2-trifluoroethoxy)benzene

Description:
4-Methyl-2-nitro-1-(2,2,2-trifluoroethoxy)benzene, with the CAS number 122142-15-8, is an organic compound characterized by its aromatic structure, which includes a methyl group and a nitro group attached to a benzene ring. The presence of the trifluoroethoxy group introduces significant electronegativity due to the fluorine atoms, influencing the compound's reactivity and solubility. This compound is likely to exhibit moderate to high stability under standard conditions, but it may undergo electrophilic substitution reactions due to the activated aromatic system. The nitro group is a strong electron-withdrawing group, which can affect the compound's acidity and reactivity. Additionally, the trifluoroethoxy moiety can enhance lipophilicity, potentially impacting its behavior in biological systems and environmental interactions. Overall, this compound's unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and interactions.
Formula:C9H8F3NO3
InChI:InChI=1S/C9H8F3NO3/c1-6-2-3-8(7(4-6)13(14)15)16-5-9(10,11)12/h2-4H,5H2,1H3
InChI key:InChIKey=BQURRAMFSNWEPB-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(N(=O)=O)C=C(C)C=C1
Synonyms:
  • 4-Methyl-2-nitro-1-(2,2,2-trifluoroethoxy)benzene
  • Benzene, 4-methyl-2-nitro-1-(2,2,2-trifluoroethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.